Ankađien công thức chung

Vậy Ankadien là gì? có tính chất hóa học và tính chất vật lý như thế nào? công thức cấu tạo của Ankađien (butađien C4H6, isopren C5H8,...)viết ra sao? được điều chế và ứng dụng vào lĩnh vực nào trong thực tế? chúng ta cùng tìm hiểu qua bài viết này.

I. Định nghĩa và phân loại Ankađien

1. Định nghĩa ankađien

- Ankađien là hiđrocacbon mạch hở có hai liên kết đôi C=C trong phân tử.

- Công thức phân tử chung của các ankađien là CnH2n-2(n 3).

* Ví dụ:công thức cấu tạo một sốankađien

propađien: CH2=C=CH2

buta-1,2-đien: CH2-C=CH-CH3

buta-1,3-đien: CH2=CH-CH=CH2

2-metylbuta-1,3-đien (isopren):

2. Phân loại ankađien

a) Ankađien có hai liên kết đôi cạnh nhau.

* Ví dụ: anlen CH2=C=CH2

b) Ankađien có hai liên kết đôi cách nhau 1 liên kết đơn được gọi là ankađien liên hợp.

* Ví dụ: buta-1,3-đien (đivinyl) CH2=CH-CH=CH2

c) Ankađien có hai liên kết đôi cách nhau từ hai liên kết đơn trở lên.

* Ví dụ: penta-1,4-đien CH2=CH-CH2-CH=CH2

- Các ankađien liên hợp như buta-1,3-đien CH2=CH-CH=CH2và isopren CH2=C(CH3)-CH=CH2có nhiều ứng dụng thực tế.

II. Tính chất hóa học của Ankađien

1. Phản ứng cộng của ankađien

- Tương tự anken, buta-1,3-đien có thể tham gia phản ứng cộng với hiđro (xúc tác niken), halogen và hiđro halogenua.

a) Ankađien cộng hiđro (ankađien + H2)

CH2=CH-CH=CH2 + 2H2CH3-CH2-CH2-CH3

b) Ankađien cộng brom (ankađien + Br2)

- Cộng 1,2 (ở nhiệt độ -800C)::

CH2=CH-CH=CH2+ Br2 (dd) CH3-CH2-CHBr-CH2Br (sản phẩm chính)

- Cộng 1,4 (ở nhiệt độ 400C):

CH2=CH-CH=CH2+ Br2 (dd) CH2Br-CH=CH-CH2Br (sản phẩm chính)

- Cộng đồng thời vào hai liên kết đôi:

CH2=CH-CH=CH2+ 2Br2 (dd)CH2Br-CHBr-CHBr-CH2Br

c) Ankađien cộng hidro halogenua (Ankađien + HBr)

- Cộng 1,2 (ở nhiệt độ -800C):

CH2=CH-CH=CH2+ HBrCH3-CH2-CHBr-CH3(sản phẩm chính)

- Cộng 1,4 (ở nhiệt độ 400C):

CH2=CH-CH=CH2+ HBrCH3-CH=CH-CH2Br (sản phẩm chính)

- Phản ứng cộng giữa ankadien với HX tuân theo quy tắcMaccopnhicop.

2. Phản ứng trùng hợp của Ankađien

- Khi có mặt kim loại natri hoặc chất xúc tác khác, buta-1,3-đien C4H8 tham gia phản ứng trùng hợp, chủ yếu trùng hợp theo kiểu 1,4 tạo thành polibutađien:

nCH2=CH-CH=CH2(-CH2-CH=CH-CH2-)n (polibutađien)

3. Phản ứng oxi hóa của Ankađien

a) Phản ứng oxi hóa hoàn toàn

* Ví dụ: 2C4H6 + 11O28CO2 + 6H2O

b) Phản ứng oxi hóa không hoàn toàn

Ankađien + KMnO4

- Buta-1,3-đien và isopren cũng làm mất màu dung dịch thuốc tím kali pemanganat (KMnO4) tương tự anken.


Để nhận biết Ankađien có thể dùng thuốc thử là dung dịch Brom hoặc dung dịch KMnO4khi đó có hiện tượng các dung dịch bị mất màu (hoặc nhạt màu).

III. Điều chế ankađien

1) Điều chế buta-1,3-đien từ butan hoặc butilen bằng cách đề hiđro hóa:

CH3-CH2-CH2-CH3CH2=CH-CH=CH2 + 2H2

2. Điều chế isopren bằng cách tách hiđro của isopentan:

CH3-CH(CH3)-CH2-CH3CH2=C(CH3)-CH=CH2 + 2H2

IV. Ứng dụng của ankađien

-Dùng buta-1,3-đien hoặc isopren để điều chế polibutađien hoặc poliisopren là những chất có tính đàn hồi cao được dùng để sản xuất cao su như: cao su buna (dùng làm lốp xe, nhựa trám thuyền), cao su isopren,...

V. Bài tập về Ankađien

* Bài 1 trang 135 SGK Hóa 11:Thế nào là ankađien, ankađien liên hợp? Viết công thức cấu tạo và gọi tên các ankađien liên hợp có công thức phân tử C4H6, C5H8.

° Lời giải bài 1 trang 135 SGK Hóa 11:

- Ankađien là hiđrocacbon mạch hở có hai liên kết đôi C=C trong phân tử.

- Ankađien có hai liên kết đôi cách nhau 1 liên kết đơn được gọi là ankađien liên hợp.

- Công thức cấu tạo của ankađien có công thức phân tử C4H6:

CH2=CH-CH=CH2: Buta-1,3-đien

- Công thức cấu tạo của ankađien có công thức phân tử C5H8:

CH2=CH-CH=CH-CH3: Penta-1,3-đien

: 2-metylbuta-1,3-đien isopren.

* Bài2 trang 135 SGK Hóa 11:Viết phương trình hóa học ( ở dạng công thức cấu tạo) của các phản ứng xảy ra khi :

a) Isopren tác dụng với hidro (xúc tác Ni)

b) Isopren tác dụng với brom trong (trong CCl4) Các chất được lấy theo tỉ lệ số mol 1 : 1 tạo ra sản phẩm theo kiểu cộng 1, 4.

c) Trùng hợp isopren theo kiểu 1,4.

° Lời giải bài2 trang 135 SGK Hóa 11:

lời giải bài 2 trang 135 sgk hóa 11

* Bài3 trang 135 SGK Hóa 11:Oxi hóa hoàn toàn 0,680 gam ankađien X thu được 1,120 lít CO2(đktc)

a) Tìm công thức phân tử của X

b) Tìm công thức cấu tạo có thể có của X

° Lời giải bài3 trang 135 SGK Hóa 11:

a) Gọi công thức phân tử của ankađienX là CnH2n-2(n 3)

- Theo bài ra, khi oxi hóa hoàn toàn 0,68g X thu được1,120 lít CO2(đktc) nên:

- Gọi a là số mol của ankađien X, Phương trình oxi hóa hoàn toàn:

CnH2n-2 + [(3n-1)/2]O2 nCO2+ (n-1)H2O

a a.n(mol)

- Theo bài ra,oxi hóa hoàn toàn 0,68g X nên ta có:

mx = (14n - 2).a = 0,68 (*)

- Theo PTPƯ và bài ra, số mol CO2 là: nCO2 = a.n = 0,05 (**)

- Từ (*) và (**) ta giải được: n = 5 và a = 0,01.

X có công thức phân tử là: C5H8

b) Tìm công thức cấu tạo có thể có của C5H8 là:






* Bài4 trang 135 SGK Hóa 11:Khi cho buta-1,3-đien tác dụng với H2ở nhiệt độ cao, có Ni làm xúc tác, có thể thu được

A. Butan B. Isobutan C. Isobutilen D. Pentan.

° Lời giải bài4 trang 135 SGK Hóa 11:

Chọn đáp án:A. Butan

- Phương trình phản ứng:

CH2=CH=CH-CH2 + 2H2CH3-CH2-CH2-CH3

* Bài 5 trang 136 SGK Hóa 11:Hợp chất nào sau đây cộng hợp H2tạo thành isopentan?

bài 5 trang 136 sgk hóa 11

° Lời giải bài5 trang 136 SGK Hóa 11:

Chọn đáp án: B. CH2=CH-C(CH3)=CH2

- Vì có phương trình phản ứng:

CH2=CH-C(CH3)=CH2+ 2H2CH3-CH2-CH(CH3)-CH3

Video liên quan